C19H13F3N4 — CID 23634232
N-(1H-pyrazol-5-yl)-1-[4-(trifluoromethyl)phenyl]isoquinolin-3-amine (PubChem CID 23634232) has the molecular formula C19H13F3N4 and a molecular weight of 354.34 g/mol. Its IUPAC name is N-(1H-pyrazol-5-yl)-1-[4-(trifluoromethyl)phenyl]isoquinolin-3-amine.
| Compound Name | N-(1H-pyrazol-5-yl)-1-[4-(trifluoromethyl)phenyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 23634232 |
| Molecular Formula | C19H13F3N4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-(1H-pyrazol-5-yl)-1-[4-(trifluoromethyl)phenyl]isoquinolin-3-amine |
| SMILES | FC(F)(F)c1ccc(-c2nc(Nc3ccn[nH]3)cc3ccccc23)cc1 |
| InChI | InChI=1S/C19H13F3N4/c20-19(21,22)14-7-5-12(6-8-14)18-15-4-2-1-3-13(15)11-17(25-18)24-16-9-10-23-26-16/h1-11H,(H2,23,24,25,26) |
| InChIKey | FEQODEHZIACDNM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |