C16H26O5 — CID 23635575
ethyl (2Z,4E,6R)-6-[(4S,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]hepta-2,4-dienoate (PubChem CID 23635575) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl (2Z,4E,6R)-6-[(4S,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]hepta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E,6R)-6-[(4S,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 23635575 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | ethyl (2Z,4E,6R)-6-[(4S,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]hepta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C\C=C\[C@@H](C)[C@@H]1C[C@@H](CO)OC(C)(C)O1 |
| InChI | InChI=1S/C16H26O5/c1-5-19-15(18)9-7-6-8-12(2)14-10-13(11-17)20-16(3,4)21-14/h6-9,12-14,17H,5,10-11H2,1-4H3/b8-6+,9-7-/t12-,13+,14+/m1/s1 |
| InChIKey | IHQWOLGPXZUQRK-ACCRDMAOSA-N |
| XLogP | 2.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|