C10H26N4 — CID 23635842
N,N'-bis(3-amino-1,1,3,3-tetradeuteriopropyl)butane-1,4-diamine (PubChem CID 23635842) has the molecular formula C10H26N4 and a molecular weight of 210.39 g/mol. Its IUPAC name is N,N'-bis(3-amino-1,1,3,3-tetradeuteriopropyl)butane-1,4-diamine.
| Compound Name | N,N'-bis(3-amino-1,1,3,3-tetradeuteriopropyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 23635842 |
| Molecular Formula | C10H26N4 |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.27 |
| IUPAC Name | N,N'-bis(3-amino-1,1,3,3-tetradeuteriopropyl)butane-1,4-diamine |
| SMILES | [2H]C([2H])(N)CC([2H])([2H])NCCCCNC([2H])([2H])CC([2H])([2H])N |
| InChI | InChI=1S/C10H26N4/c11-5-3-9-13-7-1-2-8-14-10-4-6-12/h13-14H,1-12H2/i5D2,6D2,9D2,10D2 |
| InChIKey | PFNFFQXMRSDOHW-FBUPCRGOSA-N |
| XLogP | -0.36 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|