C16H25NO — CID 23636176
(1S,2S,4R,8R)-8-butyl-2-prop-2-enyl-7-azatricyclo[5.3.0.04,8]decan-3-one (PubChem CID 23636176) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (1S,2S,4R,8R)-8-butyl-2-prop-2-enyl-7-azatricyclo[5.3.0.04,8]decan-3-one.
| Compound Name | (1S,2S,4R,8R)-8-butyl-2-prop-2-enyl-7-azatricyclo[5.3.0.04,8]decan-3-one |
|---|---|
| PubChem CID | 23636176 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (1S,2S,4R,8R)-8-butyl-2-prop-2-enyl-7-azatricyclo[5.3.0.04,8]decan-3-one |
| SMILES | C=CC[C@@H]1C(=O)[C@@H]2CCN3[C@H]1CC[C@]23CCCC |
| InChI | InChI=1S/C16H25NO/c1-3-5-9-16-10-7-14-12(6-4-2)15(18)13(16)8-11-17(14)16/h4,12-14H,2-3,5-11H2,1H3/t12-,13-,14-,16+/m0/s1 |
| InChIKey | PXCOQTRQJXXINY-RZLSGREXSA-N |
| XLogP | 3.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|