C22H41NO8 — CID 23636178
3-O-tert-butyl 5-O-methyl (4R,5S)-4-[(1S,2S)-4-hydroxy-1,2-di(propan-2-yloxy)butyl]-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate (PubChem CID 23636178) has the molecular formula C22H41NO8 and a molecular weight of 447.57 g/mol. Its IUPAC name is 3-O-tert-butyl 5-O-methyl (4R,5S)-4-[(1S,2S)-4-hydroxy-1,2-di(propan-2-yloxy)butyl]-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate.
| Compound Name | 3-O-tert-butyl 5-O-methyl (4R,5S)-4-[(1S,2S)-4-hydroxy-1,2-di(propan-2-yloxy)butyl]-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 23636178 |
| Molecular Formula | C22H41NO8 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | 3-O-tert-butyl 5-O-methyl (4R,5S)-4-[(1S,2S)-4-hydroxy-1,2-di(propan-2-yloxy)butyl]-2,2-dimethyl-1,3-oxazolidine-3,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@@H]1[C@H](OC(C)C)[C@H](CCO)OC(C)C |
| InChI | InChI=1S/C22H41NO8/c1-13(2)28-15(11-12-24)17(29-14(3)4)16-18(19(25)27-10)30-22(8,9)23(16)20(26)31-21(5,6)7/h13-18,24H,11-12H2,1-10H3/t15-,16+,17+,18-/m0/s1 |
| InChIKey | WFPRIRPJLGIWTP-MLHJIOFPSA-N |
| XLogP | 2.87 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |