C21H35NO9 — CID 24767281
methyl (2S,3aR,6R,7R,7aR)-6-(2,2-dimethylpropanoyloxy)-2-(hydroxymethyl)-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 24767281) has the molecular formula C21H35NO9 and a molecular weight of 445.51 g/mol. Its IUPAC name is methyl (2S,3aR,6R,7R,7aR)-6-(2,2-dimethylpropanoyloxy)-2-(hydroxymethyl)-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2S,3aR,6R,7R,7aR)-6-(2,2-dimethylpropanoyloxy)-2-(hydroxymethyl)-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 24767281 |
| Molecular Formula | C21H35NO9 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | methyl (2S,3aR,6R,7R,7aR)-6-(2,2-dimethylpropanoyloxy)-2-(hydroxymethyl)-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | COC(=O)[C@@]1(CO)C[C@H]2OC[C@H](OC(=O)C(C)(C)C)[C@@H](N(C)C(=O)OC(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C21H35NO9/c1-19(2,3)16(24)29-13-10-28-12-9-21(11-23,17(25)27-8)30-15(12)14(13)22(7)18(26)31-20(4,5)6/h12-15,23H,9-11H2,1-8H3/t12-,13+,14-,15+,21+/m1/s1 |
| InChIKey | ABONGTWKQZUAPF-QAXUCOGBSA-N |
| XLogP | 1.27 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|