C22H41NO7Si — CID 24767283
methyl (2S,3aR,7R,7aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 24767283) has the molecular formula C22H41NO7Si and a molecular weight of 459.66 g/mol. Its IUPAC name is methyl (2S,3aR,7R,7aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2S,3aR,7R,7aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 24767283 |
| Molecular Formula | C22H41NO7Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | methyl (2S,3aR,7R,7aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | COC(=O)[C@@]1(CO[Si](C)(C)C(C)(C)C)C[C@H]2OCC[C@@H](N(C)C(=O)OC(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C22H41NO7Si/c1-20(2,3)30-19(25)23(7)15-11-12-27-16-13-22(18(24)26-8,29-17(15)16)14-28-31(9,10)21(4,5)6/h15-17H,11-14H2,1-10H3/t15-,16-,17-,22+/m1/s1 |
| InChIKey | GWHABHTVOAXHOX-WBYLCXCBSA-N |
| XLogP | 3.73 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|