C21H39NO8Si — CID 24767382
methyl (2S,3aR,6S,7R,7aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 24767382) has the molecular formula C21H39NO8Si and a molecular weight of 461.63 g/mol. Its IUPAC name is methyl (2S,3aR,6S,7R,7aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2S,3aR,6S,7R,7aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 24767382 |
| Molecular Formula | C21H39NO8Si |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | methyl (2S,3aR,6S,7R,7aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | COC(=O)[C@@]1(CO[Si](C)(C)C(C)(C)C)C[C@H]2OC[C@@H](O)[C@@H](NC(=O)OC(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C21H39NO8Si/c1-19(2,3)30-18(25)22-15-13(23)11-27-14-10-21(17(24)26-7,29-16(14)15)12-28-31(8,9)20(4,5)6/h13-16,23H,10-12H2,1-9H3,(H,22,25)/t13-,14-,15-,16+,21+/m1/s1 |
| InChIKey | KRAUHFZAHMOJHQ-XVERXEDPSA-N |
| XLogP | 2.36 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|