C19H32N2O9 — CID 11396337
methyl (2R,3aR,6S,7R,7aR)-6-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-7-(methylamino)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 11396337) has the molecular formula C19H32N2O9 and a molecular weight of 432.47 g/mol. Its IUPAC name is methyl (2R,3aR,6S,7R,7aR)-6-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-7-(methylamino)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2R,3aR,6S,7R,7aR)-6-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-7-(methylamino)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 11396337 |
| Molecular Formula | C19H32N2O9 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | methyl (2R,3aR,6S,7R,7aR)-6-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-7-(methylamino)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | CN[C@H]1[C@H]2O[C@@](C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)(C(=O)OC)C[C@H]2OC[C@H]1O |
| InChI | InChI=1S/C19H32N2O9/c1-18(2,3)30-17(25)21-10(15(23)26-5)7-19(16(24)27-6)8-12-14(29-19)13(20-4)11(22)9-28-12/h10-14,20,22H,7-9H2,1-6H3,(H,21,25)/t10-,11+,12+,13+,14-,19+/m0/s1 |
| InChIKey | LUFWFYBJGKZVLH-ISJXSDKZSA-N |
| XLogP | -0.51 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|