C18H29NO10 — CID 11661701
methyl (2R,3aR,6S,7S,7aR)-6,7-dihydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 11661701) has the molecular formula C18H29NO10 and a molecular weight of 419.43 g/mol. Its IUPAC name is methyl (2R,3aR,6S,7S,7aR)-6,7-dihydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2R,3aR,6S,7S,7aR)-6,7-dihydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 11661701 |
| Molecular Formula | C18H29NO10 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | methyl (2R,3aR,6S,7S,7aR)-6,7-dihydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | COC(=O)[C@H](C[C@]1(C(=O)OC)C[C@H]2OC[C@H](O)[C@H](O)[C@H]2O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO10/c1-17(2,3)29-16(24)19-9(14(22)25-4)6-18(15(23)26-5)7-11-13(28-18)12(21)10(20)8-27-11/h9-13,20-21H,6-8H2,1-5H3,(H,19,24)/t9-,10-,11+,12-,13-,18+/m0/s1 |
| InChIKey | GGNGFVYOZPSKGQ-XMKLUTKVSA-N |
| XLogP | -0.74 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|