C18H29NO9 — CID 11675760
methyl (2R,3aR,7S,7aR)-7-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 11675760) has the molecular formula C18H29NO9 and a molecular weight of 403.43 g/mol. Its IUPAC name is methyl (2R,3aR,7S,7aR)-7-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2R,3aR,7S,7aR)-7-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 11675760 |
| Molecular Formula | C18H29NO9 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | methyl (2R,3aR,7S,7aR)-7-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | COC(=O)[C@H](C[C@]1(C(=O)OC)C[C@H]2OCC[C@H](O)[C@H]2O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO9/c1-17(2,3)28-16(23)19-10(14(21)24-4)8-18(15(22)25-5)9-12-13(27-18)11(20)6-7-26-12/h10-13,20H,6-9H2,1-5H3,(H,19,23)/t10-,11-,12+,13+,18+/m0/s1 |
| InChIKey | LPNAZVHPIKYRSC-BDASQDPRSA-N |
| XLogP | 0.29 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|