C20H31NO11 — CID 11605016
methyl (2R,3aR,6R,7S,7aR)-6-acetyloxy-7-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 11605016) has the molecular formula C20H31NO11 and a molecular weight of 461.46 g/mol. Its IUPAC name is methyl (2R,3aR,6R,7S,7aR)-6-acetyloxy-7-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2R,3aR,6R,7S,7aR)-6-acetyloxy-7-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 11605016 |
| Molecular Formula | C20H31NO11 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | methyl (2R,3aR,6R,7S,7aR)-6-acetyloxy-7-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | COC(=O)[C@H](C[C@]1(C(=O)OC)C[C@H]2OC[C@@H](OC(C)=O)[C@H](O)[C@H]2O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31NO11/c1-10(22)30-13-9-29-12-8-20(17(25)28-6,31-15(12)14(13)23)7-11(16(24)27-5)21-18(26)32-19(2,3)4/h11-15,23H,7-9H2,1-6H3,(H,21,26)/t11-,12+,13+,14-,15-,20+/m0/s1 |
| InChIKey | UJEYETCWAHVHNM-KTWNMUROSA-N |
| XLogP | -0.17 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|