C23H37NO11 — CID 11533471
methyl (2R,3aR,6S,7R,7aS)-7-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 11533471) has the molecular formula C23H37NO11 and a molecular weight of 503.55 g/mol. Its IUPAC name is methyl (2R,3aR,6S,7R,7aS)-7-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2R,3aR,6S,7R,7aS)-7-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 11533471 |
| Molecular Formula | C23H37NO11 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | methyl (2R,3aR,6S,7R,7aS)-7-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | COC(=O)[C@H](C[C@]1(C(=O)OC)C[C@H]2OC[C@H](O)[C@@H](OC(=O)C(C)(C)C)[C@H]2O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37NO11/c1-21(2,3)18(27)33-15-13(25)11-32-14-10-23(19(28)31-8,34-16(14)15)9-12(17(26)30-7)24-20(29)35-22(4,5)6/h12-16,25H,9-11H2,1-8H3,(H,24,29)/t12-,13-,14+,15+,16-,23+/m0/s1 |
| InChIKey | LGTSATVLVJGACI-AIOBOHOSSA-N |
| XLogP | 0.86 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|