C18H31NO7Si — CID 24766098
methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate (PubChem CID 24766098) has the molecular formula C18H31NO7Si and a molecular weight of 401.53 g/mol. Its IUPAC name is methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate.
| Compound Name | methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
|---|---|
| PubChem CID | 24766098 |
| Molecular Formula | C18H31NO7Si |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
| SMILES | COC(=O)[C@@]1(CO[Si](C)(C)C(C)(C)C)C[C@H]2OC[C@H]3OC(=O)N(C)[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C18H31NO7Si/c1-17(2,3)27(6,7)24-10-18(15(20)22-5)8-11-14(26-18)13-12(9-23-11)25-16(21)19(13)4/h11-14H,8-10H2,1-7H3/t11-,12-,13-,14+,18+/m1/s1 |
| InChIKey | GPXSMCOKLJNGKB-OSHGBCRDSA-N |
| XLogP | 1.93 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|