C19H33NO7Si — CID 24767707
methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate (PubChem CID 24767707) has the molecular formula C19H33NO7Si and a molecular weight of 415.56 g/mol. Its IUPAC name is methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate.
| Compound Name | methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
|---|---|
| PubChem CID | 24767707 |
| Molecular Formula | C19H33NO7Si |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-ethyl-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
| SMILES | CCN1C(=O)O[C@@H]2CO[C@@H]3C[C@](CO[Si](C)(C)C(C)(C)C)(C(=O)OC)O[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C19H33NO7Si/c1-8-20-14-13(26-17(20)22)10-24-12-9-19(16(21)23-5,27-15(12)14)11-25-28(6,7)18(2,3)4/h12-15H,8-11H2,1-7H3/t12-,13-,14-,15+,19+/m1/s1 |
| InChIKey | JLXHMWFBFHDKKO-SXPCIFIFSA-N |
| XLogP | 2.32 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|