C13H19NO7 — CID 24767385
methyl (1R,2R,6S,9R,11S)-3-ethyl-11-(hydroxymethyl)-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate (PubChem CID 24767385) has the molecular formula C13H19NO7 and a molecular weight of 301.30 g/mol. Its IUPAC name is methyl (1R,2R,6S,9R,11S)-3-ethyl-11-(hydroxymethyl)-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate.
| Compound Name | methyl (1R,2R,6S,9R,11S)-3-ethyl-11-(hydroxymethyl)-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
|---|---|
| PubChem CID | 24767385 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | methyl (1R,2R,6S,9R,11S)-3-ethyl-11-(hydroxymethyl)-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
| SMILES | CCN1C(=O)O[C@@H]2CO[C@@H]3C[C@](CO)(C(=O)OC)O[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C13H19NO7/c1-3-14-9-8(20-12(14)17)5-19-7-4-13(6-15,11(16)18-2)21-10(7)9/h7-10,15H,3-6H2,1-2H3/t7-,8-,9-,10+,13+/m1/s1 |
| InChIKey | PQRWXFBXTJCAQV-LGMRYKSHSA-N |
| XLogP | -0.71 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |