C15H27NO4 — CID 101447727
ethyl 2-[(1S,3S,8aS)-1-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxybutanoate (PubChem CID 101447727) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is ethyl 2-[(1S,3S,8aS)-1-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxybutanoate.
| Compound Name | ethyl 2-[(1S,3S,8aS)-1-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxybutanoate |
|---|---|
| PubChem CID | 101447727 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | ethyl 2-[(1S,3S,8aS)-1-methoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxybutanoate |
| SMILES | CCOC(=O)C(O)(CC)[C@@H]1C[C@H](OC)[C@@H]2CCCCN12 |
| InChI | InChI=1S/C15H27NO4/c1-4-15(18,14(17)20-5-2)13-10-12(19-3)11-8-6-7-9-16(11)13/h11-13,18H,4-10H2,1-3H3/t11-,12-,13-,15?/m0/s1 |
| InChIKey | QOTCAYNDQXHZHE-BOEIJXPTSA-N |
| XLogP | 1.33 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |