C18H35NO4Si — CID 23730061
ethyl (2S)-2-[(1S,3S,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxyacetate (PubChem CID 23730061) has the molecular formula C18H35NO4Si and a molecular weight of 357.57 g/mol. Its IUPAC name is ethyl (2S)-2-[(1S,3S,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxyacetate.
| Compound Name | ethyl (2S)-2-[(1S,3S,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 23730061 |
| Molecular Formula | C18H35NO4Si |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | ethyl (2S)-2-[(1S,3S,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]-2-hydroxyacetate |
| SMILES | CCOC(=O)[C@@H](O)[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CCCCN21 |
| InChI | InChI=1S/C18H35NO4Si/c1-7-22-17(21)16(20)14-12-15(13-10-8-9-11-19(13)14)23-24(5,6)18(2,3)4/h13-16,20H,7-12H2,1-6H3/t13-,14-,15-,16-/m0/s1 |
| InChIKey | NXAWSPNQGGBHSQ-VGWMRTNUSA-N |
| XLogP | 2.93 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|