C22H37NO9Si — CID 24767602
3-O-tert-butyl 11-O-methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-3,11-dicarboxylate (PubChem CID 24767602) has the molecular formula C22H37NO9Si and a molecular weight of 487.62 g/mol. Its IUPAC name is 3-O-tert-butyl 11-O-methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-3,11-dicarboxylate.
| Compound Name | 3-O-tert-butyl 11-O-methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-3,11-dicarboxylate |
|---|---|
| PubChem CID | 24767602 |
| Molecular Formula | C22H37NO9Si |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 3-O-tert-butyl 11-O-methyl (1R,2R,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-3,11-dicarboxylate |
| SMILES | COC(=O)[C@@]1(CO[Si](C)(C)C(C)(C)C)C[C@H]2OC[C@H]3OC(=O)N(C(=O)OC(C)(C)C)[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C22H37NO9Si/c1-20(2,3)32-19(26)23-15-14(30-18(23)25)11-28-13-10-22(17(24)27-7,31-16(13)15)12-29-33(8,9)21(4,5)6/h13-16H,10-12H2,1-9H3/t13-,14-,15-,16+,22+/m1/s1 |
| InChIKey | JWYHAYOVSMZGKD-UGCBNPKGSA-N |
| XLogP | 3.23 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|