C6H10O6 — CID 23638223
(1R,3R,4S,5S,6S)-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptane-4,5,6-triol (PubChem CID 23638223) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is (1R,3R,4S,5S,6S)-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptane-4,5,6-triol.
| Compound Name | (1R,3R,4S,5S,6S)-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptane-4,5,6-triol |
|---|---|
| PubChem CID | 23638223 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (1R,3R,4S,5S,6S)-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptane-4,5,6-triol |
| SMILES | OC[C@H]1O[C@@H]2O[C@@]2(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O6/c7-1-2-3(8)4(9)6(10)5(11-2)12-6/h2-5,7-10H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey | GPAYUHZDGMOMJS-DVKNGEFBSA-N |
| XLogP | -2.86 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|