C15H19BrN2O4 — CID 23640916
(2S)-1-(6-bromo-2,3-dihydroindol-1-yl)propan-2-amine;(E)-but-2-enedioic acid (PubChem CID 23640916) has the molecular formula C15H19BrN2O4 and a molecular weight of 371.23 g/mol. Its IUPAC name is (2S)-1-(6-bromo-2,3-dihydroindol-1-yl)propan-2-amine;(E)-but-2-enedioic acid.
| Compound Name | (2S)-1-(6-bromo-2,3-dihydroindol-1-yl)propan-2-amine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 23640916 |
| Molecular Formula | C15H19BrN2O4 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (2S)-1-(6-bromo-2,3-dihydroindol-1-yl)propan-2-amine;(E)-but-2-enedioic acid |
| SMILES | C[C@H](N)CN1CCc2ccc(Br)cc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H15BrN2.C4H4O4/c1-8(13)7-14-5-4-9-2-3-10(12)6-11(9)14;5-3(6)1-2-4(7)8/h2-3,6,8H,4-5,7,13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t8-;/m0./s1 |
| InChIKey | MMJHOVSNKVPKSY-LOOJJACZSA-N |
| XLogP | 1.87 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|