C17H22N2O6 — CID 69207488
but-2-enedioic acid;(2S)-1-(2,3,7,8-tetrahydro-[1,4]dioxino[2,3-g]indol-9-yl)propan-2-amine (PubChem CID 69207488) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is but-2-enedioic acid;(2S)-1-(2,3,7,8-tetrahydro-[1,4]dioxino[2,3-g]indol-9-yl)propan-2-amine.
| Compound Name | but-2-enedioic acid;(2S)-1-(2,3,7,8-tetrahydro-[1,4]dioxino[2,3-g]indol-9-yl)propan-2-amine |
|---|---|
| PubChem CID | 69207488 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | but-2-enedioic acid;(2S)-1-(2,3,7,8-tetrahydro-[1,4]dioxino[2,3-g]indol-9-yl)propan-2-amine |
| SMILES | C[C@H](N)CN1CCc2ccc3c(c21)OCCO3.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C13H18N2O2.C4H4O4/c1-9(14)8-15-5-4-10-2-3-11-13(12(10)15)17-7-6-16-11;5-3(6)1-2-4(7)8/h2-3,9H,4-8,14H2,1H3;1-2H,(H,5,6)(H,7,8)/t9-;/m0./s1 |
| InChIKey | KYAXCHWUIJMLTE-FVGYRXGTSA-N |
| XLogP | 0.88 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|