C23H21N2O3PS — CID 23642443
3-[(diphenylphosphinothioylamino)-(4-nitrophenyl)methyl]but-3-en-2-one (PubChem CID 23642443) has the molecular formula C23H21N2O3PS and a molecular weight of 436.47 g/mol. Its IUPAC name is 3-[(diphenylphosphinothioylamino)-(4-nitrophenyl)methyl]but-3-en-2-one.
| Compound Name | 3-[(diphenylphosphinothioylamino)-(4-nitrophenyl)methyl]but-3-en-2-one |
|---|---|
| PubChem CID | 23642443 |
| Molecular Formula | C23H21N2O3PS |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 3-[(diphenylphosphinothioylamino)-(4-nitrophenyl)methyl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)C(NP(=S)(c1ccccc1)c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21N2O3PS/c1-17(18(2)26)23(19-13-15-20(16-14-19)25(27)28)24-29(30,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16,23H,1H2,2H3,(H,24,30) |
| InChIKey | GYCUPNPYNDHHAS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|