C34H43IO4 — CID 23642462
[(1R,2S,3S,6R)-2-ethenyl-6-(hydroxymethyl)-2-methyl-3-phenylmethoxycyclohexyl]-[(1S)-3-iodo-2,2,4-trimethyl-1-phenylmethoxycyclohex-3-en-1-yl]methanone (PubChem CID 23642462) has the molecular formula C34H43IO4 and a molecular weight of 642.62 g/mol. Its IUPAC name is [(1R,2S,3S,6R)-2-ethenyl-6-(hydroxymethyl)-2-methyl-3-phenylmethoxycyclohexyl]-[(1S)-3-iodo-2,2,4-trimethyl-1-phenylmethoxycyclohex-3-en-1-yl]methanone.
| Compound Name | [(1R,2S,3S,6R)-2-ethenyl-6-(hydroxymethyl)-2-methyl-3-phenylmethoxycyclohexyl]-[(1S)-3-iodo-2,2,4-trimethyl-1-phenylmethoxycyclohex-3-en-1-yl]methanone |
|---|---|
| PubChem CID | 23642462 |
| Molecular Formula | C34H43IO4 |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 642.22 |
| IUPAC Name | [(1R,2S,3S,6R)-2-ethenyl-6-(hydroxymethyl)-2-methyl-3-phenylmethoxycyclohexyl]-[(1S)-3-iodo-2,2,4-trimethyl-1-phenylmethoxycyclohex-3-en-1-yl]methanone |
| SMILES | C=C[C@]1(C)[C@@H](OCc2ccccc2)CC[C@@H](CO)[C@H]1C(=O)[C@]1(OCc2ccccc2)CCC(C)=C(I)C1(C)C |
| InChI | InChI=1S/C34H43IO4/c1-6-33(5)28(38-22-25-13-9-7-10-14-25)18-17-27(21-36)29(33)31(37)34(39-23-26-15-11-8-12-16-26)20-19-24(2)30(35)32(34,3)4/h6-16,27-29,36H,1,17-23H2,2-5H3/t27-,28-,29-,33+,34+/m0/s1 |
| InChIKey | SHGIKQJAPUYPAR-XTHFZOMLSA-N |
| XLogP | 7.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|