C17H23NO2 — CID 2364287
N-(furan-2-ylmethyl)-3-(2,4,6-trimethylphenoxy)propan-1-amine (PubChem CID 2364287) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-(2,4,6-trimethylphenoxy)propan-1-amine.
| Compound Name | N-(furan-2-ylmethyl)-3-(2,4,6-trimethylphenoxy)propan-1-amine |
|---|---|
| PubChem CID | 2364287 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-(2,4,6-trimethylphenoxy)propan-1-amine |
| SMILES | Cc1cc(C)c(OCCCNCc2ccco2)c(C)c1 |
| InChI | InChI=1S/C17H23NO2/c1-13-10-14(2)17(15(3)11-13)20-9-5-7-18-12-16-6-4-8-19-16/h4,6,8,10-11,18H,5,7,9,12H2,1-3H3 |
| InChIKey | NNXRNUCPMJCEQR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|