C19H19IN2O5 — CID 23643315
(1-methylpyridin-1-ium-2-yl) (1R,5S,7R)-3-benzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylate iodide (PubChem CID 23643315) has the molecular formula C19H19IN2O5 and a molecular weight of 482.27 g/mol. Its IUPAC name is (1-methylpyridin-1-ium-2-yl) (1R,5S,7R)-3-benzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylate iodide.
| Compound Name | (1-methylpyridin-1-ium-2-yl) (1R,5S,7R)-3-benzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylate iodide |
|---|---|
| PubChem CID | 23643315 |
| Molecular Formula | C19H19IN2O5 |
| Molecular Weight | 482.27 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | (1-methylpyridin-1-ium-2-yl) (1R,5S,7R)-3-benzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylate iodide |
| SMILES | C[n+]1ccccc1OC(=O)[C@@H]1O[C@H]2CN(Cc3ccccc3)C(=O)[C@@H]1O2.[I-] |
| InChI | InChI=1S/C19H19N2O5.HI/c1-20-10-6-5-9-14(20)24-19(23)17-16-18(22)21(12-15(25-16)26-17)11-13-7-3-2-4-8-13;/h2-10,15-17H,11-12H2,1H3;1H/q+1;/p-1/t15-,16+,17+;/m0./s1 |
| InChIKey | GDIPFRSWYHNBGE-NINZUIERSA-M |
| XLogP | -2.43 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.27 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|