C38H48N4O2 — CID 23643639
(2R,4R,5Z,12R,13S,16Z)-25-(8-methoxy-9-methylpyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol (PubChem CID 23643639) has the molecular formula C38H48N4O2 and a molecular weight of 592.83 g/mol. Its IUPAC name is (2R,4R,5Z,12R,13S,16Z)-25-(8-methoxy-9-methylpyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol.
| Compound Name | (2R,4R,5Z,12R,13S,16Z)-25-(8-methoxy-9-methylpyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol |
|---|---|
| PubChem CID | 23643639 |
| Molecular Formula | C38H48N4O2 |
| Molecular Weight | 592.83 g/mol |
| Exact Mass | 592.38 |
| IUPAC Name | (2R,4R,5Z,12R,13S,16Z)-25-(8-methoxy-9-methylpyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol |
| SMILES | COc1cccc2c3ccnc(C4=C[C@@]5(O)CC/C=C\CCCCN6CCC4[C@]4(C[C@@H]7/C=C\CCCCN7[C@H]45)C6)c3n(C)c12 |
| InChI | InChI=1S/C38H48N4O2/c1-40-34-28(15-13-16-32(34)44-2)29-17-20-39-33(35(29)40)30-25-38(43)19-10-6-3-4-7-11-21-41-23-18-31(30)37(26-41)24-27-14-9-5-8-12-22-42(27)36(37)38/h3,6,9,13-17,20,25,27,31,36,43H,4-5,7-8,10-12,18-19,21-24,26H2,1-2H3/b6-3-,14-9-/t27-,31?,36+,37-,38-/m0/s1 |
| InChIKey | LANFUCOONSVQMQ-MCMDJTBWSA-N |
| XLogP | 6.87 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.83 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|