C18H11BrN4 — CID 23643747
2-amino-4-(2-bromophenyl)-9H-pyrido[2,3-b]indole-3-carbonitrile (PubChem CID 23643747) has the molecular formula C18H11BrN4 and a molecular weight of 363.22 g/mol. Its IUPAC name is 2-amino-4-(2-bromophenyl)-9H-pyrido[2,3-b]indole-3-carbonitrile.
| Compound Name | 2-amino-4-(2-bromophenyl)-9H-pyrido[2,3-b]indole-3-carbonitrile |
|---|---|
| PubChem CID | 23643747 |
| Molecular Formula | C18H11BrN4 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-amino-4-(2-bromophenyl)-9H-pyrido[2,3-b]indole-3-carbonitrile |
| SMILES | N#Cc1c(N)nc2[nH]c3ccccc3c2c1-c1ccccc1Br |
| InChI | InChI=1S/C18H11BrN4/c19-13-7-3-1-5-10(13)15-12(9-20)17(21)23-18-16(15)11-6-2-4-8-14(11)22-18/h1-8H,(H3,21,22,23) |
| InChIKey | IVTIUKHTLBQMQY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |