C21H21F2N3O2S — CID 23644743
trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-[3-(4-methylsulfanylphenyl)-1-oxidopyridin-1-ium-4-yl]cyclohexane-1-carboxamide (PubChem CID 23644743) has the molecular formula C21H21F2N3O2S and a molecular weight of 417.48 g/mol. Its IUPAC name is trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-[3-(4-methylsulfanylphenyl)-1-oxidopyridin-1-ium-4-yl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-[3-(4-methylsulfanylphenyl)-1-oxidopyridin-1-ium-4-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 23644743 |
| Molecular Formula | C21H21F2N3O2S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-[3-(4-methylsulfanylphenyl)-1-oxidopyridin-1-ium-4-yl]cyclohexane-1-carboxamide |
| SMILES | CSc1ccc(-c2c[n+]([O-])ccc2[C@@H]2CCC(F)(F)C[C@H]2C(=O)NCC#N)cc1 |
| InChI | InChI=1S/C21H21F2N3O2S/c1-29-15-4-2-14(3-5-15)19-13-26(28)11-7-17(19)16-6-8-21(22,23)12-18(16)20(27)25-10-9-24/h2-5,7,11,13,16,18H,6,8,10,12H2,1H3,(H,25,27)/t16-,18+/m0/s1 |
| InChIKey | VCBDFTWLPGEPSD-FUHWJXTLSA-N |
| XLogP | 3.87 |
| TPSA | 79.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|