C20H20FN3O4 — CID 23645078
(3Z)-5-fluoro-4-[(3R)-4-hydroxy-3-(2-hydroxyethylamino)but-1-ynyl]-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one (PubChem CID 23645078) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is (3Z)-5-fluoro-4-[(3R)-4-hydroxy-3-(2-hydroxyethylamino)but-1-ynyl]-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-fluoro-4-[(3R)-4-hydroxy-3-(2-hydroxyethylamino)but-1-ynyl]-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 23645078 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (3Z)-5-fluoro-4-[(3R)-4-hydroxy-3-(2-hydroxyethylamino)but-1-ynyl]-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
| SMILES | COc1cc[nH]c1/C=C1\C(=O)Nc2ccc(F)c(C#C[C@H](CO)NCCO)c21 |
| InChI | InChI=1S/C20H20FN3O4/c1-28-18-6-7-23-17(18)10-14-19-13(3-2-12(11-26)22-8-9-25)15(21)4-5-16(19)24-20(14)27/h4-7,10,12,22-23,25-26H,8-9,11H2,1H3,(H,24,27)/b14-10-/t12-/m1/s1 |
| InChIKey | LICPCHXULHJNTF-XTCQQWIJSA-N |
| XLogP | 0.95 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|