C20H20BrNO2S — CID 23647941
1-(4-bromothiophen-2-yl)-2-[(2-phenylmethoxyphenyl)methylamino]ethanol (PubChem CID 23647941) has the molecular formula C20H20BrNO2S and a molecular weight of 418.36 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-2-[(2-phenylmethoxyphenyl)methylamino]ethanol.
| Compound Name | 1-(4-bromothiophen-2-yl)-2-[(2-phenylmethoxyphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 23647941 |
| Molecular Formula | C20H20BrNO2S |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-2-[(2-phenylmethoxyphenyl)methylamino]ethanol |
| SMILES | OC(CNCc1ccccc1OCc1ccccc1)c1cc(Br)cs1 |
| InChI | InChI=1S/C20H20BrNO2S/c21-17-10-20(25-14-17)18(23)12-22-11-16-8-4-5-9-19(16)24-13-15-6-2-1-3-7-15/h1-10,14,18,22-23H,11-13H2 |
| InChIKey | WYXMCHIEHJQNKM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |