C15H17BrN2O3S — CID 23647947
2-[2-[[[2-(4-bromothiophen-2-yl)-2-hydroxyethyl]amino]methyl]phenoxy]acetamide (PubChem CID 23647947) has the molecular formula C15H17BrN2O3S and a molecular weight of 385.28 g/mol. Its IUPAC name is 2-[2-[[[2-(4-bromothiophen-2-yl)-2-hydroxyethyl]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-[[[2-(4-bromothiophen-2-yl)-2-hydroxyethyl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 23647947 |
| Molecular Formula | C15H17BrN2O3S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 2-[2-[[[2-(4-bromothiophen-2-yl)-2-hydroxyethyl]amino]methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccccc1CNCC(O)c1cc(Br)cs1 |
| InChI | InChI=1S/C15H17BrN2O3S/c16-11-5-14(22-9-11)12(19)7-18-6-10-3-1-2-4-13(10)21-8-15(17)20/h1-5,9,12,18-19H,6-8H2,(H2,17,20) |
| InChIKey | QZUPAPSTAHZYQS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |