C10H7ClN2O2 — CID 23648518
6-chloro-5-phenyl-1H-pyrimidine-2,4-dione (PubChem CID 23648518) has the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. Its IUPAC name is 6-chloro-5-phenyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-5-phenyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23648518 |
| Molecular Formula | C10H7ClN2O2 |
| Molecular Weight | 222.63 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 6-chloro-5-phenyl-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(Cl)c(-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H7ClN2O2/c11-8-7(6-4-2-1-3-5-6)9(14)13-10(15)12-8/h1-5H,(H2,12,13,14,15) |
| InChIKey | ORRYLQRWCPCGJZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.63 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |