C12H11ClN2O2 — CID 23648519
6-chloro-5-(3,5-dimethylphenyl)-1H-pyrimidine-2,4-dione (PubChem CID 23648519) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is 6-chloro-5-(3,5-dimethylphenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-5-(3,5-dimethylphenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23648519 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 6-chloro-5-(3,5-dimethylphenyl)-1H-pyrimidine-2,4-dione |
| SMILES | Cc1cc(C)cc(-c2c(Cl)[nH]c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C12H11ClN2O2/c1-6-3-7(2)5-8(4-6)9-10(13)14-12(17)15-11(9)16/h3-5H,1-2H3,(H2,14,15,16,17) |
| InChIKey | DGJASMNUPJUOQH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |