C13H12N2O4 — CID 750201
6-methoxy-1-(2-phenylacetyl)pyrimidine-2,4-dione (PubChem CID 750201) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 6-methoxy-1-(2-phenylacetyl)pyrimidine-2,4-dione.
| Compound Name | 6-methoxy-1-(2-phenylacetyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 750201 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 6-methoxy-1-(2-phenylacetyl)pyrimidine-2,4-dione |
| SMILES | COc1cc(=O)[nH]c(=O)n1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H12N2O4/c1-19-12-8-10(16)14-13(18)15(12)11(17)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,14,16,18) |
| InChIKey | XLWKRKZCLXLKAC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |