C16H20O4 — CID 23650731
(3Z)-3-[(Z)-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)but-3-en-2-ylidene]oxolan-2-one (PubChem CID 23650731) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3Z)-3-[(Z)-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)but-3-en-2-ylidene]oxolan-2-one.
| Compound Name | (3Z)-3-[(Z)-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)but-3-en-2-ylidene]oxolan-2-one |
|---|---|
| PubChem CID | 23650731 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3Z)-3-[(Z)-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)but-3-en-2-ylidene]oxolan-2-one |
| SMILES | CC(/C=C\C1=CCC2(CC1)OCCO2)=C1\CCOC1=O |
| InChI | InChI=1S/C16H20O4/c1-12(14-6-9-18-15(14)17)2-3-13-4-7-16(8-5-13)19-10-11-20-16/h2-4H,5-11H2,1H3/b3-2-,14-12- |
| InChIKey | DDLUNBOKJNCSNV-SYJYLZRKSA-N |
| XLogP | 2.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|