C19H20N2O4S2 — CID 23650914
(2-sulfanylidene-1-pyridinyl) (1R,2S,4S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 23650914) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) (1R,2S,4S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) (1R,2S,4S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23650914 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) (1R,2S,4S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H]3CC[C@@H]2[C@@H](C(=O)On2ccccc2=S)C3)cc1 |
| InChI | InChI=1S/C19H20N2O4S2/c1-13-5-8-15(9-6-13)27(23,24)21-14-7-10-17(21)16(12-14)19(22)25-20-11-3-2-4-18(20)26/h2-6,8-9,11,14,16-17H,7,10,12H2,1H3/t14-,16-,17+/m0/s1 |
| InChIKey | JXLVTSZRVMIQOB-BHYGNILZSA-N |
| XLogP | 2.72 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|