C29H38N2O7S — CID 23651857
(2R,3S,5R,6R)-2-(hydroxymethyl)-6-[[4-[[2-methyl-4-(2-phenylmethoxyethoxy)phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]thiane-3,4,5-triol (PubChem CID 23651857) has the molecular formula C29H38N2O7S and a molecular weight of 558.70 g/mol. Its IUPAC name is (2R,3S,5R,6R)-2-(hydroxymethyl)-6-[[4-[[2-methyl-4-(2-phenylmethoxyethoxy)phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]thiane-3,4,5-triol.
| Compound Name | (2R,3S,5R,6R)-2-(hydroxymethyl)-6-[[4-[[2-methyl-4-(2-phenylmethoxyethoxy)phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 23651857 |
| Molecular Formula | C29H38N2O7S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | (2R,3S,5R,6R)-2-(hydroxymethyl)-6-[[4-[[2-methyl-4-(2-phenylmethoxyethoxy)phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]thiane-3,4,5-triol |
| SMILES | Cc1cc(OCCOCc2ccccc2)ccc1Cc1c(O[C@@H]2S[C@H](CO)[C@@H](O)C(O)[C@H]2O)n[nH]c1C(C)C |
| InChI | InChI=1S/C29H38N2O7S/c1-17(2)24-22(28(31-30-24)38-29-27(35)26(34)25(33)23(15-32)39-29)14-20-9-10-21(13-18(20)3)37-12-11-36-16-19-7-5-4-6-8-19/h4-10,13,17,23,25-27,29,32-35H,11-12,14-16H2,1-3H3,(H,30,31)/t23-,25-,26?,27-,29-/m1/s1 |
| InChIKey | MWKUBHOAIGDNBY-GJKTXXROSA-N |
| XLogP | 2.92 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|