C26H33N5O6S — CID 42605549
1-[4-[[5-propan-2-yl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 42605549) has the molecular formula C26H33N5O6S and a molecular weight of 543.65 g/mol. Its IUPAC name is 1-[4-[[5-propan-2-yl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[[5-propan-2-yl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 42605549 |
| Molecular Formula | C26H33N5O6S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 1-[4-[[5-propan-2-yl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CC(C)c1[nH]nc(O[C@@H]2S[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1Cc1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C26H33N5O6S/c1-14(2)20-18(24(31-30-20)37-25-23(35)22(34)21(33)19(13-32)38-25)10-15-5-7-17(8-6-15)29-26(36)28-12-16-4-3-9-27-11-16/h3-9,11,14,19,21-23,25,32-35H,10,12-13H2,1-2H3,(H,30,31)(H2,28,29,36)/t19-,21-,22+,23-,25-/m1/s1 |
| InChIKey | ZETVQWVNTQCXOQ-FGBFUVBKSA-N |
| XLogP | 1.74 |
| TPSA | 172.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |