C18H16ClFN4O2 — CID 23652117
5-chloro-N-[(4-fluorophenyl)methyl]-8-hydroxy-2-(methylaminomethyl)-1,6-naphthyridine-7-carboxamide (PubChem CID 23652117) has the molecular formula C18H16ClFN4O2 and a molecular weight of 374.80 g/mol. Its IUPAC name is 5-chloro-N-[(4-fluorophenyl)methyl]-8-hydroxy-2-(methylaminomethyl)-1,6-naphthyridine-7-carboxamide.
| Compound Name | 5-chloro-N-[(4-fluorophenyl)methyl]-8-hydroxy-2-(methylaminomethyl)-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 23652117 |
| Molecular Formula | C18H16ClFN4O2 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 5-chloro-N-[(4-fluorophenyl)methyl]-8-hydroxy-2-(methylaminomethyl)-1,6-naphthyridine-7-carboxamide |
| SMILES | CNCc1ccc2c(Cl)nc(C(=O)NCc3ccc(F)cc3)c(O)c2n1 |
| InChI | InChI=1S/C18H16ClFN4O2/c1-21-9-12-6-7-13-14(23-12)16(25)15(24-17(13)19)18(26)22-8-10-2-4-11(20)5-3-10/h2-7,21,25H,8-9H2,1H3,(H,22,26) |
| InChIKey | VHXYPMPQMJSFQK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|