C13H14F3IN2O2 — CID 23654198
3-iodo-1,5-dimethyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one (PubChem CID 23654198) has the molecular formula C13H14F3IN2O2 and a molecular weight of 414.17 g/mol. Its IUPAC name is 3-iodo-1,5-dimethyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one.
| Compound Name | 3-iodo-1,5-dimethyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one |
|---|---|
| PubChem CID | 23654198 |
| Molecular Formula | C13H14F3IN2O2 |
| Molecular Weight | 414.17 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 3-iodo-1,5-dimethyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one |
| SMILES | CC1CN(C(=O)C(F)(F)F)CCc2c1cc(I)c(=O)n2C |
| InChI | InChI=1S/C13H14F3IN2O2/c1-7-6-19(12(21)13(14,15)16)4-3-10-8(7)5-9(17)11(20)18(10)2/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | UKPBTCIUOAUAMS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|