C19H29NO8 — CID 23655863
methyl (5S,6S,7S)-5,8-dihydroxy-6-(methoxymethoxy)-7-(phenylmethoxycarbonylamino)octanoate (PubChem CID 23655863) has the molecular formula C19H29NO8 and a molecular weight of 399.44 g/mol. Its IUPAC name is methyl (5S,6S,7S)-5,8-dihydroxy-6-(methoxymethoxy)-7-(phenylmethoxycarbonylamino)octanoate.
| Compound Name | methyl (5S,6S,7S)-5,8-dihydroxy-6-(methoxymethoxy)-7-(phenylmethoxycarbonylamino)octanoate |
|---|---|
| PubChem CID | 23655863 |
| Molecular Formula | C19H29NO8 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | methyl (5S,6S,7S)-5,8-dihydroxy-6-(methoxymethoxy)-7-(phenylmethoxycarbonylamino)octanoate |
| SMILES | COCO[C@@H]([C@H](CO)NC(=O)OCc1ccccc1)[C@@H](O)CCCC(=O)OC |
| InChI | InChI=1S/C19H29NO8/c1-25-13-28-18(16(22)9-6-10-17(23)26-2)15(11-21)20-19(24)27-12-14-7-4-3-5-8-14/h3-5,7-8,15-16,18,21-22H,6,9-13H2,1-2H3,(H,20,24)/t15-,16-,18-/m0/s1 |
| InChIKey | PRLOIHAYEFBVAD-BQFCYCMXSA-N |
| XLogP | 0.97 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|