C22H17BF4OS — CID 23655967
18-methoxy-3-methyl-3-thioniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16(21),17,19-decaene tetrafluoroborate (PubChem CID 23655967) has the molecular formula C22H17BF4OS and a molecular weight of 416.25 g/mol. Its IUPAC name is 18-methoxy-3-methyl-3-thioniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16(21),17,19-decaene tetrafluoroborate.
| Compound Name | 18-methoxy-3-methyl-3-thioniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16(21),17,19-decaene tetrafluoroborate |
|---|---|
| PubChem CID | 23655967 |
| Molecular Formula | C22H17BF4OS |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 18-methoxy-3-methyl-3-thioniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16(21),17,19-decaene tetrafluoroborate |
| SMILES | COc1ccc2c(ccc3ccc4c5ccccc5[s+](C)c4c32)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C22H17OS.BF4/c1-23-16-10-12-17-15(13-16)8-7-14-9-11-19-18-5-3-4-6-20(18)24(2)22(19)21(14)17;2-1(3,4)5/h3-13H,1-2H3;/q+1;-1 |
| InChIKey | DFTWDDQGWJUIIH-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|