C11H11N3S2 — CID 23656200
(Z)-3-anilino-2-cyano-3-methylsulfanylprop-2-enethioamide (PubChem CID 23656200) has the molecular formula C11H11N3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is (Z)-3-anilino-2-cyano-3-methylsulfanylprop-2-enethioamide.
| Compound Name | (Z)-3-anilino-2-cyano-3-methylsulfanylprop-2-enethioamide |
|---|---|
| PubChem CID | 23656200 |
| Molecular Formula | C11H11N3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | (Z)-3-anilino-2-cyano-3-methylsulfanylprop-2-enethioamide |
| SMILES | CS/C(Nc1ccccc1)=C(/C#N)C(N)=S |
| InChI | InChI=1S/C11H11N3S2/c1-16-11(9(7-12)10(13)15)14-8-5-3-2-4-6-8/h2-6,14H,1H3,(H2,13,15)/b11-9- |
| InChIKey | IGMBXBCYCSMSOX-LUAWRHEFSA-N |
| XLogP | 2.48 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|