C24H27N3O9S2 — CID 102390182
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-3-amino-1-anilino-2-cyano-3-sulfanylideneprop-1-enyl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 102390182) has the molecular formula C24H27N3O9S2 and a molecular weight of 565.63 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-3-amino-1-anilino-2-cyano-3-sulfanylideneprop-1-enyl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-3-amino-1-anilino-2-cyano-3-sulfanylideneprop-1-enyl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102390182 |
| Molecular Formula | C24H27N3O9S2 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-3-amino-1-anilino-2-cyano-3-sulfanylideneprop-1-enyl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](S/C(Nc2ccccc2)=C(\C#N)C(N)=S)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H27N3O9S2/c1-12(28)32-11-18-19(33-13(2)29)20(34-14(3)30)21(35-15(4)31)24(36-18)38-23(17(10-25)22(26)37)27-16-8-6-5-7-9-16/h5-9,18-21,24,27H,11H2,1-4H3,(H2,26,37)/b23-17+/t18-,19-,20+,21-,24-/m1/s1 |
| InChIKey | FUSRSKIZBZYCEV-RDRRCULOSA-N |
| XLogP | 1.94 |
| TPSA | 176.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|