C26H26N2O10S2 — CID 42625962
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,2-dicyano-1-phenacylsulfanylethenyl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 42625962) has the molecular formula C26H26N2O10S2 and a molecular weight of 590.63 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,2-dicyano-1-phenacylsulfanylethenyl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,2-dicyano-1-phenacylsulfanylethenyl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 42625962 |
| Molecular Formula | C26H26N2O10S2 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,2-dicyano-1-phenacylsulfanylethenyl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SC(SCC(=O)c2ccccc2)=C(C#N)C#N)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H26N2O10S2/c1-14(29)34-12-21-22(35-15(2)30)23(36-16(3)31)24(37-17(4)32)25(38-21)40-26(19(10-27)11-28)39-13-20(33)18-8-6-5-7-9-18/h5-9,21-25H,12-13H2,1-4H3/t21-,22+,23+,24-,25+/m1/s1 |
| InChIKey | PBVTYKLCGNWZPJ-MQZWXTIWSA-N |
| XLogP | 2.68 |
| TPSA | 179.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|