C21H27NO11S2 — CID 42626117
ethyl (Z)-2-cyano-3-methylsulfanyl-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylprop-2-enoate (PubChem CID 42626117) has the molecular formula C21H27NO11S2 and a molecular weight of 533.58 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-methylsulfanyl-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylprop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-methylsulfanyl-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylprop-2-enoate |
|---|---|
| PubChem CID | 42626117 |
| Molecular Formula | C21H27NO11S2 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | ethyl (Z)-2-cyano-3-methylsulfanyl-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C(/SC)S[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H27NO11S2/c1-7-28-19(27)14(8-22)21(34-6)35-20-18(32-13(5)26)17(31-12(4)25)16(30-11(3)24)15(33-20)9-29-10(2)23/h15-18,20H,7,9H2,1-6H3/b21-14-/t15-,16-,17+,18-,20+/m1/s1 |
| InChIKey | LQBFIMYGRBMLKS-XENUVOBWSA-N |
| XLogP | 1.46 |
| TPSA | 164.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|