C22H34N4O7S — CID 23656767
S-[(E)-4-[(6R,9R,12R,16S)-9,12-dimethyl-2,5,8,11,14-pentaoxo-6-propan-2-yl-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] ethanethioate (PubChem CID 23656767) has the molecular formula C22H34N4O7S and a molecular weight of 498.60 g/mol. Its IUPAC name is S-[(E)-4-[(6R,9R,12R,16S)-9,12-dimethyl-2,5,8,11,14-pentaoxo-6-propan-2-yl-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] ethanethioate.
| Compound Name | S-[(E)-4-[(6R,9R,12R,16S)-9,12-dimethyl-2,5,8,11,14-pentaoxo-6-propan-2-yl-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 23656767 |
| Molecular Formula | C22H34N4O7S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | S-[(E)-4-[(6R,9R,12R,16S)-9,12-dimethyl-2,5,8,11,14-pentaoxo-6-propan-2-yl-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCC/C=C/[C@@H]1CC(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C(C)C)C(=O)NCC(=O)O1 |
| InChI | InChI=1S/C22H34N4O7S/c1-12(2)19-22(32)23-11-18(29)33-16(8-6-7-9-34-15(5)27)10-17(28)24-13(3)20(30)25-14(4)21(31)26-19/h6,8,12-14,16,19H,7,9-11H2,1-5H3,(H,23,32)(H,24,28)(H,25,30)(H,26,31)/b8-6+/t13-,14-,16-,19-/m1/s1 |
| InChIKey | DSOSPBZVBBLRHS-MGYDIJNBSA-N |
| XLogP | -0.21 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|