About ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate
ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate (PubChem CID 23658364) has the molecular formula C22H28O5
and a molecular weight of 372.46 g/mol. Its IUPAC name is ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate.
Molecular Properties
| Compound Name | ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate |
| PubChem CID | 23658364 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate |
| SMILES | C=C(c1ccccc1)C1COC2(CCC(=C(CC)C(=O)OCC)CC2)OO1 |
| InChI | InChI=1S/C22H28O5/c1-4-19(21(23)24-5-2)18-11-13-22(14-12-18)25-15-20(26-27-22)16(3)17-9-7-6-8-10-17/h6-10,20H,3-5,11-15H2,1-2H3/b19-18- |
| InChIKey | GXPLYYNEOXKWJM-HNENSFHCSA-N |
| XLogP | 4.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate?
The IUPAC name of ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate (CID 23658364) is ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate.
What is the SMILES notation for ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate?
The canonical SMILES for ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate is C=C(c1ccccc1)C1COC2(CCC(=C(CC)C(=O)OCC)CC2)OO1.
What is the InChIKey of ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate?
The InChIKey is GXPLYYNEOXKWJM-HNENSFHCSA-N. The full InChI is InChI=1S/C22H28O5/c1-4-19(21(23)24-5-2)18-11-13-22(14-12-18)25-15-20(26-27-22)16(3)17-9-7-6-8-10-17/h6-10,20H,3-5,11-15H2,1-2H3/b19-18-.
What are the key properties of ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate?
ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate has a molecular weight of 372.46 g/mol, XLogP of 4.59, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(1-phenylethenyl)-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]butanoate is sourced from PubChem (CID 23658364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).