C10H9BrN2O — CID 23658983
(2Z)-2-[(4-bromophenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 23658983) has the molecular formula C10H9BrN2O and a molecular weight of 253.10 g/mol. Its IUPAC name is (2Z)-2-[(4-bromophenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-[(4-bromophenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 23658983 |
| Molecular Formula | C10H9BrN2O |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | (2Z)-2-[(4-bromophenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N/[N+](=C\c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C10H9BrN2O/c11-9-3-1-8(2-4-9)7-13-6-5-10(14)12-13/h1-4,7H,5-6H2/b13-7- |
| InChIKey | NIMRRXJXJCLOPO-QPEQYQDCSA-N |
| XLogP | 0.96 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|